C24H33NO — CID 18640270
1-[(1R)-3-oxocyclohexyl]-4-(4-pentylphenyl)cyclohexane-1-carbonitrile (PubChem CID 18640270) has the molecular formula C24H33NO and a molecular weight of 351.53 g/mol. Its IUPAC name is 1-[(1R)-3-oxocyclohexyl]-4-(4-pentylphenyl)cyclohexane-1-carbonitrile.
| Compound Name | 1-[(1R)-3-oxocyclohexyl]-4-(4-pentylphenyl)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 18640270 |
| Molecular Formula | C24H33NO |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.26 |
| IUPAC Name | 1-[(1R)-3-oxocyclohexyl]-4-(4-pentylphenyl)cyclohexane-1-carbonitrile |
| SMILES | CCCCCc1ccc(C2CCC(C#N)([C@@H]3CCCC(=O)C3)CC2)cc1 |
| InChI | InChI=1S/C24H33NO/c1-2-3-4-6-19-9-11-20(12-10-19)21-13-15-24(18-25,16-14-21)22-7-5-8-23(26)17-22/h9-12,21-22H,2-8,13-17H2,1H3/t21?,22-,24?/m1/s1 |
| InChIKey | LKLMUAQELGTMJX-XERBYJISSA-N |
| XLogP | 6.35 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|