C34H45NO2 — CID 70371383
4-[4-(4-hexoxyphenyl)phenyl]-1-[(1R,4R)-3-oxo-4-propylcyclohexyl]cyclohexane-1-carbonitrile (PubChem CID 70371383) has the molecular formula C34H45NO2 and a molecular weight of 499.74 g/mol. Its IUPAC name is 4-[4-(4-hexoxyphenyl)phenyl]-1-[(1R,4R)-3-oxo-4-propylcyclohexyl]cyclohexane-1-carbonitrile.
| Compound Name | 4-[4-(4-hexoxyphenyl)phenyl]-1-[(1R,4R)-3-oxo-4-propylcyclohexyl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 70371383 |
| Molecular Formula | C34H45NO2 |
| Molecular Weight | 499.74 g/mol |
| Exact Mass | 499.35 |
| IUPAC Name | 4-[4-(4-hexoxyphenyl)phenyl]-1-[(1R,4R)-3-oxo-4-propylcyclohexyl]cyclohexane-1-carbonitrile |
| SMILES | CCCCCCOc1ccc(-c2ccc(C3CCC(C#N)([C@@H]4CC[C@@H](CCC)C(=O)C4)CC3)cc2)cc1 |
| InChI | InChI=1S/C34H45NO2/c1-3-5-6-7-23-37-32-17-14-28(15-18-32)26-9-11-27(12-10-26)29-19-21-34(25-35,22-20-29)31-16-13-30(8-4-2)33(36)24-31/h9-12,14-15,17-18,29-31H,3-8,13,16,19-24H2,1-2H3/t29?,30-,31-,34?/m1/s1 |
| InChIKey | SPSJDAVHPKLGSH-JHCAPHELSA-N |
| XLogP | 9.27 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.74 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|