C14H18BrNS — CID 65402873
1-[(4-bromothiophen-2-yl)methyl]-3-ethylcyclohexane-1-carbonitrile (PubChem CID 65402873) has the molecular formula C14H18BrNS and a molecular weight of 312.28 g/mol. Its IUPAC name is 1-[(4-bromothiophen-2-yl)methyl]-3-ethylcyclohexane-1-carbonitrile.
| Compound Name | 1-[(4-bromothiophen-2-yl)methyl]-3-ethylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 65402873 |
| Molecular Formula | C14H18BrNS |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 1-[(4-bromothiophen-2-yl)methyl]-3-ethylcyclohexane-1-carbonitrile |
| SMILES | CCC1CCCC(C#N)(Cc2cc(Br)cs2)C1 |
| InChI | InChI=1S/C14H18BrNS/c1-2-11-4-3-5-14(7-11,10-16)8-13-6-12(15)9-17-13/h6,9,11H,2-5,7-8H2,1H3 |
| InChIKey | IBERIYXDOXPXJM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |