C15H17FN2O2 — CID 65414726
3-ethyl-1-[(5-fluoro-2-nitrophenyl)methyl]cyclopentane-1-carbonitrile (PubChem CID 65414726) has the molecular formula C15H17FN2O2 and a molecular weight of 276.31 g/mol. Its IUPAC name is 3-ethyl-1-[(5-fluoro-2-nitrophenyl)methyl]cyclopentane-1-carbonitrile.
| Compound Name | 3-ethyl-1-[(5-fluoro-2-nitrophenyl)methyl]cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 65414726 |
| Molecular Formula | C15H17FN2O2 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 3-ethyl-1-[(5-fluoro-2-nitrophenyl)methyl]cyclopentane-1-carbonitrile |
| SMILES | CCC1CCC(C#N)(Cc2cc(F)ccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C15H17FN2O2/c1-2-11-5-6-15(8-11,10-17)9-12-7-13(16)3-4-14(12)18(19)20/h3-4,7,11H,2,5-6,8-9H2,1H3 |
| InChIKey | LGOAQCGXDMOZOU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 66.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|