C14H14BrF5O — CID 106265387
1-[(3-bromo-2,6-difluorophenyl)methyl]-3-(trifluoromethyl)cyclohexan-1-ol (PubChem CID 106265387) has the molecular formula C14H14BrF5O and a molecular weight of 373.16 g/mol. Its IUPAC name is 1-[(3-bromo-2,6-difluorophenyl)methyl]-3-(trifluoromethyl)cyclohexan-1-ol.
| Compound Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]-3-(trifluoromethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 106265387 |
| Molecular Formula | C14H14BrF5O |
| Molecular Weight | 373.16 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]-3-(trifluoromethyl)cyclohexan-1-ol |
| SMILES | OC1(Cc2c(F)ccc(Br)c2F)CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C14H14BrF5O/c15-10-3-4-11(16)9(12(10)17)7-13(21)5-1-2-8(6-13)14(18,19)20/h3-4,8,21H,1-2,5-7H2 |
| InChIKey | ZQGNGRHYMRZZRP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.16 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|