C13H15BrF2O — CID 106273685
[1-[(3-bromo-2,6-difluorophenyl)methyl]cyclopentyl]methanol (PubChem CID 106273685) has the molecular formula C13H15BrF2O and a molecular weight of 305.16 g/mol. Its IUPAC name is [1-[(3-bromo-2,6-difluorophenyl)methyl]cyclopentyl]methanol.
| Compound Name | [1-[(3-bromo-2,6-difluorophenyl)methyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 106273685 |
| Molecular Formula | C13H15BrF2O |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | [1-[(3-bromo-2,6-difluorophenyl)methyl]cyclopentyl]methanol |
| SMILES | OCC1(Cc2c(F)ccc(Br)c2F)CCCC1 |
| InChI | InChI=1S/C13H15BrF2O/c14-10-3-4-11(15)9(12(10)16)7-13(8-17)5-1-2-6-13/h3-4,17H,1-2,5-8H2 |
| InChIKey | RFUJONSIRDGBTP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|