C16H20BrF2NO — CID 106272814
1-[1-(aminomethyl)cyclohexyl]-3-(3-bromo-2,6-difluorophenyl)propan-2-one (PubChem CID 106272814) has the molecular formula C16H20BrF2NO and a molecular weight of 360.24 g/mol. Its IUPAC name is 1-[1-(aminomethyl)cyclohexyl]-3-(3-bromo-2,6-difluorophenyl)propan-2-one.
| Compound Name | 1-[1-(aminomethyl)cyclohexyl]-3-(3-bromo-2,6-difluorophenyl)propan-2-one |
|---|---|
| PubChem CID | 106272814 |
| Molecular Formula | C16H20BrF2NO |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 1-[1-(aminomethyl)cyclohexyl]-3-(3-bromo-2,6-difluorophenyl)propan-2-one |
| SMILES | NCC1(CC(=O)Cc2c(F)ccc(Br)c2F)CCCCC1 |
| InChI | InChI=1S/C16H20BrF2NO/c17-13-4-5-14(18)12(15(13)19)8-11(21)9-16(10-20)6-2-1-3-7-16/h4-5H,1-3,6-10,20H2 |
| InChIKey | SWLBBXHSTFKKTE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|