C16H21BrFNO — CID 116614498
1-[1-(aminomethyl)cyclohexyl]-3-(5-bromo-2-fluorophenyl)propan-2-one (PubChem CID 116614498) has the molecular formula C16H21BrFNO and a molecular weight of 342.25 g/mol. Its IUPAC name is 1-[1-(aminomethyl)cyclohexyl]-3-(5-bromo-2-fluorophenyl)propan-2-one.
| Compound Name | 1-[1-(aminomethyl)cyclohexyl]-3-(5-bromo-2-fluorophenyl)propan-2-one |
|---|---|
| PubChem CID | 116614498 |
| Molecular Formula | C16H21BrFNO |
| Molecular Weight | 342.25 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 1-[1-(aminomethyl)cyclohexyl]-3-(5-bromo-2-fluorophenyl)propan-2-one |
| SMILES | NCC1(CC(=O)Cc2cc(Br)ccc2F)CCCCC1 |
| InChI | InChI=1S/C16H21BrFNO/c17-13-4-5-15(18)12(8-13)9-14(20)10-16(11-19)6-2-1-3-7-16/h4-5,8H,1-3,6-7,9-11,19H2 |
| InChIKey | HVEYWPZWTSLCCF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.25 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |