C14H17BrFNO — CID 116601033
1-[1-(aminomethyl)cyclopentyl]-2-(4-bromo-2-fluorophenyl)ethanone (PubChem CID 116601033) has the molecular formula C14H17BrFNO and a molecular weight of 314.20 g/mol. Its IUPAC name is 1-[1-(aminomethyl)cyclopentyl]-2-(4-bromo-2-fluorophenyl)ethanone.
| Compound Name | 1-[1-(aminomethyl)cyclopentyl]-2-(4-bromo-2-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 116601033 |
| Molecular Formula | C14H17BrFNO |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 1-[1-(aminomethyl)cyclopentyl]-2-(4-bromo-2-fluorophenyl)ethanone |
| SMILES | NCC1(C(=O)Cc2ccc(Br)cc2F)CCCC1 |
| InChI | InChI=1S/C14H17BrFNO/c15-11-4-3-10(12(16)8-11)7-13(18)14(9-17)5-1-2-6-14/h3-4,8H,1-2,5-7,9,17H2 |
| InChIKey | YNPICVSFBQWMIT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |