C13H15BrFNO2 — CID 63132459
3-[(4-bromo-2-fluorophenyl)methyl]piperidine-3-carboxylic acid (PubChem CID 63132459) has the molecular formula C13H15BrFNO2 and a molecular weight of 316.17 g/mol. Its IUPAC name is 3-[(4-bromo-2-fluorophenyl)methyl]piperidine-3-carboxylic acid.
| Compound Name | 3-[(4-bromo-2-fluorophenyl)methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63132459 |
| Molecular Formula | C13H15BrFNO2 |
| Molecular Weight | 316.17 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 3-[(4-bromo-2-fluorophenyl)methyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1(Cc2ccc(Br)cc2F)CCCNC1 |
| InChI | InChI=1S/C13H15BrFNO2/c14-10-3-2-9(11(15)6-10)7-13(12(17)18)4-1-5-16-8-13/h2-3,6,16H,1,4-5,7-8H2,(H,17,18) |
| InChIKey | WUPLRINFYBLURS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.17 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |