C15H18BrFO2 — CID 103450671
2-(4-bromo-2-fluorophenyl)-1-(1-hydroxy-4-methylcyclohexyl)ethanone (PubChem CID 103450671) has the molecular formula C15H18BrFO2 and a molecular weight of 329.21 g/mol. Its IUPAC name is 2-(4-bromo-2-fluorophenyl)-1-(1-hydroxy-4-methylcyclohexyl)ethanone.
| Compound Name | 2-(4-bromo-2-fluorophenyl)-1-(1-hydroxy-4-methylcyclohexyl)ethanone |
|---|---|
| PubChem CID | 103450671 |
| Molecular Formula | C15H18BrFO2 |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 2-(4-bromo-2-fluorophenyl)-1-(1-hydroxy-4-methylcyclohexyl)ethanone |
| SMILES | CC1CCC(O)(C(=O)Cc2ccc(Br)cc2F)CC1 |
| InChI | InChI=1S/C15H18BrFO2/c1-10-4-6-15(19,7-5-10)14(18)8-11-2-3-12(16)9-13(11)17/h2-3,9-10,19H,4-8H2,1H3 |
| InChIKey | UDOMCKYWMJSAQA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |