C16H20BrFO — CID 107186821
2-(4-bromo-2-fluorophenyl)-1-(2,2-dimethylcyclohexyl)ethanone (PubChem CID 107186821) has the molecular formula C16H20BrFO and a molecular weight of 327.24 g/mol. Its IUPAC name is 2-(4-bromo-2-fluorophenyl)-1-(2,2-dimethylcyclohexyl)ethanone.
| Compound Name | 2-(4-bromo-2-fluorophenyl)-1-(2,2-dimethylcyclohexyl)ethanone |
|---|---|
| PubChem CID | 107186821 |
| Molecular Formula | C16H20BrFO |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 2-(4-bromo-2-fluorophenyl)-1-(2,2-dimethylcyclohexyl)ethanone |
| SMILES | CC1(C)CCCCC1C(=O)Cc1ccc(Br)cc1F |
| InChI | InChI=1S/C16H20BrFO/c1-16(2)8-4-3-5-13(16)15(19)9-11-6-7-12(17)10-14(11)18/h6-7,10,13H,3-5,8-9H2,1-2H3 |
| InChIKey | ITGJROZRRQEIJR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |