C9H9BrFNO — CID 71270704
2-(4-bromo-2-fluorophenyl)-N-methylacetamide (PubChem CID 71270704) has the molecular formula C9H9BrFNO and a molecular weight of 246.08 g/mol. Its IUPAC name is 2-(4-bromo-2-fluorophenyl)-N-methylacetamide.
| Compound Name | 2-(4-bromo-2-fluorophenyl)-N-methylacetamide |
|---|---|
| PubChem CID | 71270704 |
| Molecular Formula | C9H9BrFNO |
| Molecular Weight | 246.08 g/mol |
| Exact Mass | 244.99 |
| IUPAC Name | 2-(4-bromo-2-fluorophenyl)-N-methylacetamide |
| SMILES | CNC(=O)Cc1ccc(Br)cc1F |
| InChI | InChI=1S/C9H9BrFNO/c1-12-9(13)4-6-2-3-7(10)5-8(6)11/h2-3,5H,4H2,1H3,(H,12,13) |
| InChIKey | HYJUYPDIBLNHJI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.08 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |