C10H11BrFNO2 — CID 124707474
N-[(4-bromo-2-fluorophenyl)methyl]-3-hydroxypropanamide (PubChem CID 124707474) has the molecular formula C10H11BrFNO2 and a molecular weight of 276.10 g/mol. Its IUPAC name is N-[(4-bromo-2-fluorophenyl)methyl]-3-hydroxypropanamide.
| Compound Name | N-[(4-bromo-2-fluorophenyl)methyl]-3-hydroxypropanamide |
|---|---|
| PubChem CID | 124707474 |
| Molecular Formula | C10H11BrFNO2 |
| Molecular Weight | 276.10 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | N-[(4-bromo-2-fluorophenyl)methyl]-3-hydroxypropanamide |
| SMILES | O=C(CCO)NCc1ccc(Br)cc1F |
| InChI | InChI=1S/C10H11BrFNO2/c11-8-2-1-7(9(12)5-8)6-13-10(15)3-4-14/h1-2,5,14H,3-4,6H2,(H,13,15) |
| InChIKey | OOFFDBBWKCLNOZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.10 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |