C16H21ClFNO — CID 116602151
1-[1-(aminomethyl)cycloheptyl]-2-(2-chloro-4-fluorophenyl)ethanone (PubChem CID 116602151) has the molecular formula C16H21ClFNO and a molecular weight of 297.80 g/mol. Its IUPAC name is 1-[1-(aminomethyl)cycloheptyl]-2-(2-chloro-4-fluorophenyl)ethanone.
| Compound Name | 1-[1-(aminomethyl)cycloheptyl]-2-(2-chloro-4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 116602151 |
| Molecular Formula | C16H21ClFNO |
| Molecular Weight | 297.80 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 1-[1-(aminomethyl)cycloheptyl]-2-(2-chloro-4-fluorophenyl)ethanone |
| SMILES | NCC1(C(=O)Cc2ccc(F)cc2Cl)CCCCCC1 |
| InChI | InChI=1S/C16H21ClFNO/c17-14-10-13(18)6-5-12(14)9-15(20)16(11-19)7-3-1-2-4-8-16/h5-6,10H,1-4,7-9,11,19H2 |
| InChIKey | HRWSOFONEOSGCC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.80 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |