C15H18BrF2NO — CID 106266149
2-(3-bromo-2,6-difluorophenyl)-1-[1-(dimethylamino)cyclopentyl]ethanone (PubChem CID 106266149) has the molecular formula C15H18BrF2NO and a molecular weight of 346.22 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-1-[1-(dimethylamino)cyclopentyl]ethanone.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-1-[1-(dimethylamino)cyclopentyl]ethanone |
|---|---|
| PubChem CID | 106266149 |
| Molecular Formula | C15H18BrF2NO |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-1-[1-(dimethylamino)cyclopentyl]ethanone |
| SMILES | CN(C)C1(C(=O)Cc2c(F)ccc(Br)c2F)CCCC1 |
| InChI | InChI=1S/C15H18BrF2NO/c1-19(2)15(7-3-4-8-15)13(20)9-10-12(17)6-5-11(16)14(10)18/h5-6H,3-4,7-9H2,1-2H3 |
| InChIKey | AKLPSCVQCLKEAB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|