C17H23BrFNO — CID 79063369
2-(3-bromo-4-fluorophenyl)-1-[1-(dimethylamino)cycloheptyl]ethanone (PubChem CID 79063369) has the molecular formula C17H23BrFNO and a molecular weight of 356.28 g/mol. Its IUPAC name is 2-(3-bromo-4-fluorophenyl)-1-[1-(dimethylamino)cycloheptyl]ethanone.
| Compound Name | 2-(3-bromo-4-fluorophenyl)-1-[1-(dimethylamino)cycloheptyl]ethanone |
|---|---|
| PubChem CID | 79063369 |
| Molecular Formula | C17H23BrFNO |
| Molecular Weight | 356.28 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 2-(3-bromo-4-fluorophenyl)-1-[1-(dimethylamino)cycloheptyl]ethanone |
| SMILES | CN(C)C1(C(=O)Cc2ccc(F)c(Br)c2)CCCCCC1 |
| InChI | InChI=1S/C17H23BrFNO/c1-20(2)17(9-5-3-4-6-10-17)16(21)12-13-7-8-15(19)14(18)11-13/h7-8,11H,3-6,9-10,12H2,1-2H3 |
| InChIKey | KFVBGFVQLZBGNV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.28 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |