C15H19BrFNO — CID 116568586
2-(3-bromo-4-fluorophenyl)-1-(3-ethylpiperidin-3-yl)ethanone (PubChem CID 116568586) has the molecular formula C15H19BrFNO and a molecular weight of 328.22 g/mol. Its IUPAC name is 2-(3-bromo-4-fluorophenyl)-1-(3-ethylpiperidin-3-yl)ethanone.
| Compound Name | 2-(3-bromo-4-fluorophenyl)-1-(3-ethylpiperidin-3-yl)ethanone |
|---|---|
| PubChem CID | 116568586 |
| Molecular Formula | C15H19BrFNO |
| Molecular Weight | 328.22 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 2-(3-bromo-4-fluorophenyl)-1-(3-ethylpiperidin-3-yl)ethanone |
| SMILES | CCC1(C(=O)Cc2ccc(F)c(Br)c2)CCCNC1 |
| InChI | InChI=1S/C15H19BrFNO/c1-2-15(6-3-7-18-10-15)14(19)9-11-4-5-13(17)12(16)8-11/h4-5,8,18H,2-3,6-7,9-10H2,1H3 |
| InChIKey | CSLANVRGEVBYOW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.22 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |