C13H14BrFO2 — CID 103447608
2-(3-bromo-4-fluorophenyl)-1-(1-hydroxycyclopentyl)ethanone (PubChem CID 103447608) has the molecular formula C13H14BrFO2 and a molecular weight of 301.15 g/mol. Its IUPAC name is 2-(3-bromo-4-fluorophenyl)-1-(1-hydroxycyclopentyl)ethanone.
| Compound Name | 2-(3-bromo-4-fluorophenyl)-1-(1-hydroxycyclopentyl)ethanone |
|---|---|
| PubChem CID | 103447608 |
| Molecular Formula | C13H14BrFO2 |
| Molecular Weight | 301.15 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 2-(3-bromo-4-fluorophenyl)-1-(1-hydroxycyclopentyl)ethanone |
| SMILES | O=C(Cc1ccc(F)c(Br)c1)C1(O)CCCC1 |
| InChI | InChI=1S/C13H14BrFO2/c14-10-7-9(3-4-11(10)15)8-12(16)13(17)5-1-2-6-13/h3-4,7,17H,1-2,5-6,8H2 |
| InChIKey | WKTMKZTXPOPBCT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.15 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |