C15H18ClFO2 — CID 114012649
2-(4-chloro-3-fluorophenyl)-1-(1-hydroxycycloheptyl)ethanone (PubChem CID 114012649) has the molecular formula C15H18ClFO2 and a molecular weight of 284.76 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenyl)-1-(1-hydroxycycloheptyl)ethanone.
| Compound Name | 2-(4-chloro-3-fluorophenyl)-1-(1-hydroxycycloheptyl)ethanone |
|---|---|
| PubChem CID | 114012649 |
| Molecular Formula | C15H18ClFO2 |
| Molecular Weight | 284.76 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-(4-chloro-3-fluorophenyl)-1-(1-hydroxycycloheptyl)ethanone |
| SMILES | O=C(Cc1ccc(Cl)c(F)c1)C1(O)CCCCCC1 |
| InChI | InChI=1S/C15H18ClFO2/c16-12-6-5-11(9-13(12)17)10-14(18)15(19)7-3-1-2-4-8-15/h5-6,9,19H,1-4,7-8,10H2 |
| InChIKey | IWSYEEAWYRVAKW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.76 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |