C13H12ClF4NO — CID 107890031
2-(4-chloro-3-fluorophenyl)-1-[3-(trifluoromethyl)pyrrolidin-3-yl]ethanone (PubChem CID 107890031) has the molecular formula C13H12ClF4NO and a molecular weight of 309.69 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenyl)-1-[3-(trifluoromethyl)pyrrolidin-3-yl]ethanone.
| Compound Name | 2-(4-chloro-3-fluorophenyl)-1-[3-(trifluoromethyl)pyrrolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 107890031 |
| Molecular Formula | C13H12ClF4NO |
| Molecular Weight | 309.69 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 2-(4-chloro-3-fluorophenyl)-1-[3-(trifluoromethyl)pyrrolidin-3-yl]ethanone |
| SMILES | O=C(Cc1ccc(Cl)c(F)c1)C1(C(F)(F)F)CCNC1 |
| InChI | InChI=1S/C13H12ClF4NO/c14-9-2-1-8(5-10(9)15)6-11(20)12(13(16,17)18)3-4-19-7-12/h1-2,5,19H,3-4,6-7H2 |
| InChIKey | GVRHUTUUFBAIAB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.69 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |