C10H8ClF3O — CID 130985316
1-(4-chloro-3-fluorophenyl)-3,3-difluorobutan-2-one (PubChem CID 130985316) has the molecular formula C10H8ClF3O and a molecular weight of 236.62 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)-3,3-difluorobutan-2-one.
| Compound Name | 1-(4-chloro-3-fluorophenyl)-3,3-difluorobutan-2-one |
|---|---|
| PubChem CID | 130985316 |
| Molecular Formula | C10H8ClF3O |
| Molecular Weight | 236.62 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)-3,3-difluorobutan-2-one |
| SMILES | CC(F)(F)C(=O)Cc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C10H8ClF3O/c1-10(13,14)9(15)5-6-2-3-7(11)8(12)4-6/h2-4H,5H2,1H3 |
| InChIKey | FXCKJMUPDOPGHR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.62 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |