C13H16ClFO2 — CID 107883005
2-[(4-chloro-3-fluorophenyl)methyl]-2-methylpentanoic acid (PubChem CID 107883005) has the molecular formula C13H16ClFO2 and a molecular weight of 258.72 g/mol. Its IUPAC name is 2-[(4-chloro-3-fluorophenyl)methyl]-2-methylpentanoic acid.
| Compound Name | 2-[(4-chloro-3-fluorophenyl)methyl]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 107883005 |
| Molecular Formula | C13H16ClFO2 |
| Molecular Weight | 258.72 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 2-[(4-chloro-3-fluorophenyl)methyl]-2-methylpentanoic acid |
| SMILES | CCCC(C)(Cc1ccc(Cl)c(F)c1)C(=O)O |
| InChI | InChI=1S/C13H16ClFO2/c1-3-6-13(2,12(16)17)8-9-4-5-10(14)11(15)7-9/h4-5,7H,3,6,8H2,1-2H3,(H,16,17) |
| InChIKey | NMDHJJBDFCLSMF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.72 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |