C12H10F6N2O — CID 63719915
3-(trifluoromethyl)-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide (PubChem CID 63719915) has the molecular formula C12H10F6N2O and a molecular weight of 312.21 g/mol. Its IUPAC name is 3-(trifluoromethyl)-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide.
| Compound Name | 3-(trifluoromethyl)-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 63719915 |
| Molecular Formula | C12H10F6N2O |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 3-(trifluoromethyl)-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)C1(C(F)(F)F)CCNC1 |
| InChI | InChI=1S/C12H10F6N2O/c13-7-3-6(4-8(14)9(7)15)20-10(21)11(12(16,17)18)1-2-19-5-11/h3-4,19H,1-2,5H2,(H,20,21) |
| InChIKey | ZMHJBZBDJCKJPF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|