C13H14BrF3N2O2 — CID 82861189
N-(4-bromo-3-methoxyphenyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide (PubChem CID 82861189) has the molecular formula C13H14BrF3N2O2 and a molecular weight of 367.17 g/mol. Its IUPAC name is N-(4-bromo-3-methoxyphenyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide.
| Compound Name | N-(4-bromo-3-methoxyphenyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 82861189 |
| Molecular Formula | C13H14BrF3N2O2 |
| Molecular Weight | 367.17 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | N-(4-bromo-3-methoxyphenyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide |
| SMILES | COc1cc(NC(=O)C2(C(F)(F)F)CCNC2)ccc1Br |
| InChI | InChI=1S/C13H14BrF3N2O2/c1-21-10-6-8(2-3-9(10)14)19-11(20)12(13(15,16)17)4-5-18-7-12/h2-3,6,18H,4-5,7H2,1H3,(H,19,20) |
| InChIKey | CHQGIMOUCCLYEJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.17 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |