C13H12BrF4NO — CID 116572798
2-(3-bromo-5-fluorophenyl)-1-[3-(trifluoromethyl)pyrrolidin-3-yl]ethanone (PubChem CID 116572798) has the molecular formula C13H12BrF4NO and a molecular weight of 354.14 g/mol. Its IUPAC name is 2-(3-bromo-5-fluorophenyl)-1-[3-(trifluoromethyl)pyrrolidin-3-yl]ethanone.
| Compound Name | 2-(3-bromo-5-fluorophenyl)-1-[3-(trifluoromethyl)pyrrolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 116572798 |
| Molecular Formula | C13H12BrF4NO |
| Molecular Weight | 354.14 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | 2-(3-bromo-5-fluorophenyl)-1-[3-(trifluoromethyl)pyrrolidin-3-yl]ethanone |
| SMILES | O=C(Cc1cc(F)cc(Br)c1)C1(C(F)(F)F)CCNC1 |
| InChI | InChI=1S/C13H12BrF4NO/c14-9-3-8(4-10(15)6-9)5-11(20)12(13(16,17)18)1-2-19-7-12/h3-4,6,19H,1-2,5,7H2 |
| InChIKey | WQFSDJFRZPJMFQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.14 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |