C16H20ClFO2 — CID 107884128
2-(4-chloro-3-fluorophenyl)-1-(1-methoxycycloheptyl)ethanone (PubChem CID 107884128) has the molecular formula C16H20ClFO2 and a molecular weight of 298.78 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenyl)-1-(1-methoxycycloheptyl)ethanone.
| Compound Name | 2-(4-chloro-3-fluorophenyl)-1-(1-methoxycycloheptyl)ethanone |
|---|---|
| PubChem CID | 107884128 |
| Molecular Formula | C16H20ClFO2 |
| Molecular Weight | 298.78 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-(4-chloro-3-fluorophenyl)-1-(1-methoxycycloheptyl)ethanone |
| SMILES | COC1(C(=O)Cc2ccc(Cl)c(F)c2)CCCCCC1 |
| InChI | InChI=1S/C16H20ClFO2/c1-20-16(8-4-2-3-5-9-16)15(19)11-12-6-7-13(17)14(18)10-12/h6-7,10H,2-5,8-9,11H2,1H3 |
| InChIKey | LLRRVIQRDMTFKZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.78 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |