C17H23FO3 — CID 116748238
1-(1-ethoxycyclohexyl)-2-(3-fluoro-4-methoxyphenyl)ethanone (PubChem CID 116748238) has the molecular formula C17H23FO3 and a molecular weight of 294.37 g/mol. Its IUPAC name is 1-(1-ethoxycyclohexyl)-2-(3-fluoro-4-methoxyphenyl)ethanone.
| Compound Name | 1-(1-ethoxycyclohexyl)-2-(3-fluoro-4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 116748238 |
| Molecular Formula | C17H23FO3 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 1-(1-ethoxycyclohexyl)-2-(3-fluoro-4-methoxyphenyl)ethanone |
| SMILES | CCOC1(C(=O)Cc2ccc(OC)c(F)c2)CCCCC1 |
| InChI | InChI=1S/C17H23FO3/c1-3-21-17(9-5-4-6-10-17)16(19)12-13-7-8-15(20-2)14(18)11-13/h7-8,11H,3-6,9-10,12H2,1-2H3 |
| InChIKey | OTLZOIPVXMQLAG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |