C19H26O2 — CID 116748406
2-(2,3-dihydro-1H-inden-5-yl)-1-(1-ethoxycyclohexyl)ethanone (PubChem CID 116748406) has the molecular formula C19H26O2 and a molecular weight of 286.41 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-yl)-1-(1-ethoxycyclohexyl)ethanone.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-yl)-1-(1-ethoxycyclohexyl)ethanone |
|---|---|
| PubChem CID | 116748406 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-yl)-1-(1-ethoxycyclohexyl)ethanone |
| SMILES | CCOC1(C(=O)Cc2ccc3c(c2)CCC3)CCCCC1 |
| InChI | InChI=1S/C19H26O2/c1-2-21-19(11-4-3-5-12-19)18(20)14-15-9-10-16-7-6-8-17(16)13-15/h9-10,13H,2-8,11-12,14H2,1H3 |
| InChIKey | CUERTYIJHJAPKC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |