C17H24O3 — CID 116747950
1-(1-ethoxycyclopentyl)-2-(2-methoxy-5-methylphenyl)ethanone (PubChem CID 116747950) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-(1-ethoxycyclopentyl)-2-(2-methoxy-5-methylphenyl)ethanone.
| Compound Name | 1-(1-ethoxycyclopentyl)-2-(2-methoxy-5-methylphenyl)ethanone |
|---|---|
| PubChem CID | 116747950 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 1-(1-ethoxycyclopentyl)-2-(2-methoxy-5-methylphenyl)ethanone |
| SMILES | CCOC1(C(=O)Cc2cc(C)ccc2OC)CCCC1 |
| InChI | InChI=1S/C17H24O3/c1-4-20-17(9-5-6-10-17)16(18)12-14-11-13(2)7-8-15(14)19-3/h7-8,11H,4-6,9-10,12H2,1-3H3 |
| InChIKey | OZZBVOVEIVENJO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |