C15H19FO2 — CID 116747889
1-(1-ethoxycyclopentyl)-2-(3-fluorophenyl)ethanone (PubChem CID 116747889) has the molecular formula C15H19FO2 and a molecular weight of 250.31 g/mol. Its IUPAC name is 1-(1-ethoxycyclopentyl)-2-(3-fluorophenyl)ethanone.
| Compound Name | 1-(1-ethoxycyclopentyl)-2-(3-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 116747889 |
| Molecular Formula | C15H19FO2 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 1-(1-ethoxycyclopentyl)-2-(3-fluorophenyl)ethanone |
| SMILES | CCOC1(C(=O)Cc2cccc(F)c2)CCCC1 |
| InChI | InChI=1S/C15H19FO2/c1-2-18-15(8-3-4-9-15)14(17)11-12-6-5-7-13(16)10-12/h5-7,10H,2-4,8-9,11H2,1H3 |
| InChIKey | TUVFNUWHLKGVNJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |