C17H23FO2 — CID 116749463
1-(1-ethoxy-4-methylcyclohexyl)-2-(3-fluorophenyl)ethanone (PubChem CID 116749463) has the molecular formula C17H23FO2 and a molecular weight of 278.37 g/mol. Its IUPAC name is 1-(1-ethoxy-4-methylcyclohexyl)-2-(3-fluorophenyl)ethanone.
| Compound Name | 1-(1-ethoxy-4-methylcyclohexyl)-2-(3-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 116749463 |
| Molecular Formula | C17H23FO2 |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1-(1-ethoxy-4-methylcyclohexyl)-2-(3-fluorophenyl)ethanone |
| SMILES | CCOC1(C(=O)Cc2cccc(F)c2)CCC(C)CC1 |
| InChI | InChI=1S/C17H23FO2/c1-3-20-17(9-7-13(2)8-10-17)16(19)12-14-5-4-6-15(18)11-14/h4-6,11,13H,3,7-10,12H2,1-2H3 |
| InChIKey | NRZPVDQEUDOARD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |