C18H25BrO2 — CID 116750033
2-(3-bromophenyl)-1-(1-ethoxy-4,4-dimethylcyclohexyl)ethanone (PubChem CID 116750033) has the molecular formula C18H25BrO2 and a molecular weight of 353.30 g/mol. Its IUPAC name is 2-(3-bromophenyl)-1-(1-ethoxy-4,4-dimethylcyclohexyl)ethanone.
| Compound Name | 2-(3-bromophenyl)-1-(1-ethoxy-4,4-dimethylcyclohexyl)ethanone |
|---|---|
| PubChem CID | 116750033 |
| Molecular Formula | C18H25BrO2 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 2-(3-bromophenyl)-1-(1-ethoxy-4,4-dimethylcyclohexyl)ethanone |
| SMILES | CCOC1(C(=O)Cc2cccc(Br)c2)CCC(C)(C)CC1 |
| InChI | InChI=1S/C18H25BrO2/c1-4-21-18(10-8-17(2,3)9-11-18)16(20)13-14-6-5-7-15(19)12-14/h5-7,12H,4,8-11,13H2,1-3H3 |
| InChIKey | YCNNOKQWVMLWLU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |