C13H24O2 — CID 83226738
1-(1-ethoxy-4,4-dimethylcyclohexyl)propan-1-one (PubChem CID 83226738) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is 1-(1-ethoxy-4,4-dimethylcyclohexyl)propan-1-one.
| Compound Name | 1-(1-ethoxy-4,4-dimethylcyclohexyl)propan-1-one |
|---|---|
| PubChem CID | 83226738 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 1-(1-ethoxy-4,4-dimethylcyclohexyl)propan-1-one |
| SMILES | CCOC1(C(=O)CC)CCC(C)(C)CC1 |
| InChI | InChI=1S/C13H24O2/c1-5-11(14)13(15-6-2)9-7-12(3,4)8-10-13/h5-10H2,1-4H3 |
| InChIKey | DFVWPAXHTWPGBT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |