C15H28O2 — CID 116750112
1-(1-ethoxy-4,4-dimethylcyclohexyl)-3-methylbutan-1-one (PubChem CID 116750112) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is 1-(1-ethoxy-4,4-dimethylcyclohexyl)-3-methylbutan-1-one.
| Compound Name | 1-(1-ethoxy-4,4-dimethylcyclohexyl)-3-methylbutan-1-one |
|---|---|
| PubChem CID | 116750112 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 1-(1-ethoxy-4,4-dimethylcyclohexyl)-3-methylbutan-1-one |
| SMILES | CCOC1(C(=O)CC(C)C)CCC(C)(C)CC1 |
| InChI | InChI=1S/C15H28O2/c1-6-17-15(13(16)11-12(2)3)9-7-14(4,5)8-10-15/h12H,6-11H2,1-5H3 |
| InChIKey | PHEHGORPLSHFGJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |