About 1-(1-methoxy-4,4-dimethylcyclohexyl)-4-methylpentan-1-one
1-(1-methoxy-4,4-dimethylcyclohexyl)-4-methylpentan-1-one (PubChem CID 116750172) has the molecular formula C15H28O2
and a molecular weight of 240.39 g/mol. Its IUPAC name is 1-(1-methoxy-4,4-dimethylcyclohexyl)-4-methylpentan-1-one.
Molecular Properties
| Compound Name | 1-(1-methoxy-4,4-dimethylcyclohexyl)-4-methylpentan-1-one |
| PubChem CID | 116750172 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 1-(1-methoxy-4,4-dimethylcyclohexyl)-4-methylpentan-1-one |
| SMILES | COC1(C(=O)CCC(C)C)CCC(C)(C)CC1 |
| InChI | InChI=1S/C15H28O2/c1-12(2)6-7-13(16)15(17-5)10-8-14(3,4)9-11-15/h12H,6-11H2,1-5H3 |
| InChIKey | INAKYNBRJRQUKI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1-methoxy-4,4-dimethylcyclohexyl)-4-methylpentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methoxy-4,4-dimethylcyclohexyl)-4-methylpentan-1-one?
The IUPAC name of 1-(1-methoxy-4,4-dimethylcyclohexyl)-4-methylpentan-1-one (CID 116750172) is 1-(1-methoxy-4,4-dimethylcyclohexyl)-4-methylpentan-1-one.
What is the SMILES notation for 1-(1-methoxy-4,4-dimethylcyclohexyl)-4-methylpentan-1-one?
The canonical SMILES for 1-(1-methoxy-4,4-dimethylcyclohexyl)-4-methylpentan-1-one is COC1(C(=O)CCC(C)C)CCC(C)(C)CC1.
What is the InChIKey of 1-(1-methoxy-4,4-dimethylcyclohexyl)-4-methylpentan-1-one?
The InChIKey is INAKYNBRJRQUKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O2/c1-12(2)6-7-13(16)15(17-5)10-8-14(3,4)9-11-15/h12H,6-11H2,1-5H3.
What are the key properties of 1-(1-methoxy-4,4-dimethylcyclohexyl)-4-methylpentan-1-one?
1-(1-methoxy-4,4-dimethylcyclohexyl)-4-methylpentan-1-one has a molecular weight of 240.39 g/mol, XLogP of 3.98, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methoxy-4,4-dimethylcyclohexyl)-4-methylpentan-1-one is sourced from PubChem (CID 116750172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).