C17H32O2 — CID 116750123
1-(1-ethoxy-4,4-dimethylcyclohexyl)-5-methylhexan-1-one (PubChem CID 116750123) has the molecular formula C17H32O2 and a molecular weight of 268.44 g/mol. Its IUPAC name is 1-(1-ethoxy-4,4-dimethylcyclohexyl)-5-methylhexan-1-one.
| Compound Name | 1-(1-ethoxy-4,4-dimethylcyclohexyl)-5-methylhexan-1-one |
|---|---|
| PubChem CID | 116750123 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | 1-(1-ethoxy-4,4-dimethylcyclohexyl)-5-methylhexan-1-one |
| SMILES | CCOC1(C(=O)CCCC(C)C)CCC(C)(C)CC1 |
| InChI | InChI=1S/C17H32O2/c1-6-19-17(12-10-16(4,5)11-13-17)15(18)9-7-8-14(2)3/h14H,6-13H2,1-5H3 |
| InChIKey | WZUCQJNUBOBCGN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |