C14H22O2 — CID 116750085
1-(1-ethoxy-4,4-dimethylcyclohexyl)but-3-yn-1-one (PubChem CID 116750085) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-(1-ethoxy-4,4-dimethylcyclohexyl)but-3-yn-1-one.
| Compound Name | 1-(1-ethoxy-4,4-dimethylcyclohexyl)but-3-yn-1-one |
|---|---|
| PubChem CID | 116750085 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 1-(1-ethoxy-4,4-dimethylcyclohexyl)but-3-yn-1-one |
| SMILES | C#CCC(=O)C1(OCC)CCC(C)(C)CC1 |
| InChI | InChI=1S/C14H22O2/c1-5-7-12(15)14(16-6-2)10-8-13(3,4)9-11-14/h1H,6-11H2,2-4H3 |
| InChIKey | DAZXWZHISVCFDI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|