C15H19FO3 — CID 80685144
2-(3-fluoro-4-methoxyphenyl)-1-(2-methyloxan-2-yl)ethanone (PubChem CID 80685144) has the molecular formula C15H19FO3 and a molecular weight of 266.31 g/mol. Its IUPAC name is 2-(3-fluoro-4-methoxyphenyl)-1-(2-methyloxan-2-yl)ethanone.
| Compound Name | 2-(3-fluoro-4-methoxyphenyl)-1-(2-methyloxan-2-yl)ethanone |
|---|---|
| PubChem CID | 80685144 |
| Molecular Formula | C15H19FO3 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-(3-fluoro-4-methoxyphenyl)-1-(2-methyloxan-2-yl)ethanone |
| SMILES | COc1ccc(CC(=O)C2(C)CCCCO2)cc1F |
| InChI | InChI=1S/C15H19FO3/c1-15(7-3-4-8-19-15)14(17)10-11-5-6-13(18-2)12(16)9-11/h5-6,9H,3-4,7-8,10H2,1-2H3 |
| InChIKey | SWORTTNASJKOOD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |