C15H18Cl2O2 — CID 103450708
2-(3,4-dichlorophenyl)-1-(1-hydroxy-4-methylcyclohexyl)ethanone (PubChem CID 103450708) has the molecular formula C15H18Cl2O2 and a molecular weight of 301.21 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1-(1-hydroxy-4-methylcyclohexyl)ethanone.
| Compound Name | 2-(3,4-dichlorophenyl)-1-(1-hydroxy-4-methylcyclohexyl)ethanone |
|---|---|
| PubChem CID | 103450708 |
| Molecular Formula | C15H18Cl2O2 |
| Molecular Weight | 301.21 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1-(1-hydroxy-4-methylcyclohexyl)ethanone |
| SMILES | CC1CCC(O)(C(=O)Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C15H18Cl2O2/c1-10-4-6-15(19,7-5-10)14(18)9-11-2-3-12(16)13(17)8-11/h2-3,8,10,19H,4-7,9H2,1H3 |
| InChIKey | LOKMREVYYTZBPX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.21 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |