C15H19Cl2NO2 — CID 163319563
2-(3,4-dichlorophenyl)-N-(4-methoxycyclohexyl)acetamide (PubChem CID 163319563) has the molecular formula C15H19Cl2NO2 and a molecular weight of 316.23 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-(4-methoxycyclohexyl)acetamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-(4-methoxycyclohexyl)acetamide |
|---|---|
| PubChem CID | 163319563 |
| Molecular Formula | C15H19Cl2NO2 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-(4-methoxycyclohexyl)acetamide |
| SMILES | COC1CCC(NC(=O)Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C15H19Cl2NO2/c1-20-12-5-3-11(4-6-12)18-15(19)9-10-2-7-13(16)14(17)8-10/h2,7-8,11-12H,3-6,9H2,1H3,(H,18,19) |
| InChIKey | VYRWVVHLWWJRAG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |