C15H19Cl2NO3 — CID 91774837
2-(3,4-dichlorophenyl)-N-[(3S,4R)-3-ethoxyoxan-4-yl]acetamide (PubChem CID 91774837) has the molecular formula C15H19Cl2NO3 and a molecular weight of 332.23 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-[(3S,4R)-3-ethoxyoxan-4-yl]acetamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-[(3S,4R)-3-ethoxyoxan-4-yl]acetamide |
|---|---|
| PubChem CID | 91774837 |
| Molecular Formula | C15H19Cl2NO3 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-[(3S,4R)-3-ethoxyoxan-4-yl]acetamide |
| SMILES | CCO[C@@H]1COCC[C@H]1NC(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H19Cl2NO3/c1-2-21-14-9-20-6-5-13(14)18-15(19)8-10-3-4-11(16)12(17)7-10/h3-4,7,13-14H,2,5-6,8-9H2,1H3,(H,18,19)/t13-,14-/m1/s1 |
| InChIKey | CSQAAWIWPYCNKP-ZIAGYGMSSA-N |
| XLogP | 2.85 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |