C20H30N2O3 — CID 91776740
N-[(3S,4R)-3-ethoxyoxan-4-yl]-2-(4-phenylpiperidin-1-yl)acetamide (PubChem CID 91776740) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is N-[(3S,4R)-3-ethoxyoxan-4-yl]-2-(4-phenylpiperidin-1-yl)acetamide.
| Compound Name | N-[(3S,4R)-3-ethoxyoxan-4-yl]-2-(4-phenylpiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 91776740 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | N-[(3S,4R)-3-ethoxyoxan-4-yl]-2-(4-phenylpiperidin-1-yl)acetamide |
| SMILES | CCO[C@@H]1COCC[C@H]1NC(=O)CN1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H30N2O3/c1-2-25-19-15-24-13-10-18(19)21-20(23)14-22-11-8-17(9-12-22)16-6-4-3-5-7-16/h3-7,17-19H,2,8-15H2,1H3,(H,21,23)/t18-,19-/m1/s1 |
| InChIKey | FIXHVTWYBCJMMT-RTBURBONSA-N |
| XLogP | 2.18 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |