C18H26N2O4 — CID 91764505
N-[(3S,4R)-3-ethoxyoxan-4-yl]-4-morpholin-4-ylbenzamide (PubChem CID 91764505) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[(3S,4R)-3-ethoxyoxan-4-yl]-4-morpholin-4-ylbenzamide.
| Compound Name | N-[(3S,4R)-3-ethoxyoxan-4-yl]-4-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 91764505 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | N-[(3S,4R)-3-ethoxyoxan-4-yl]-4-morpholin-4-ylbenzamide |
| SMILES | CCO[C@@H]1COCC[C@H]1NC(=O)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H26N2O4/c1-2-24-17-13-23-10-7-16(17)19-18(21)14-3-5-15(6-4-14)20-8-11-22-12-9-20/h3-6,16-17H,2,7-13H2,1H3,(H,19,21)/t16-,17-/m1/s1 |
| InChIKey | ALZOZRSAHUDOGA-IAGOWNOFSA-N |
| XLogP | 1.45 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |