C17H22FNO4 — CID 91770821
4-fluoro-3-hydroxy-N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]benzamide (PubChem CID 91770821) has the molecular formula C17H22FNO4 and a molecular weight of 323.36 g/mol. Its IUPAC name is 4-fluoro-3-hydroxy-N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]benzamide.
| Compound Name | 4-fluoro-3-hydroxy-N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]benzamide |
|---|---|
| PubChem CID | 91770821 |
| Molecular Formula | C17H22FNO4 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 4-fluoro-3-hydroxy-N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]benzamide |
| SMILES | CC(C)=CCO[C@@H]1COCC[C@H]1NC(=O)c1ccc(F)c(O)c1 |
| InChI | InChI=1S/C17H22FNO4/c1-11(2)5-8-23-16-10-22-7-6-14(16)19-17(21)12-3-4-13(18)15(20)9-12/h3-5,9,14,16,20H,6-8,10H2,1-2H3,(H,19,21)/t14-,16-/m1/s1 |
| InChIKey | HVCLWXCPKBHHTC-GDBMZVCRSA-N |
| XLogP | 2.40 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|