C16H24N4O3 — CID 164630030
2-amino-6-methyl-N-[(3R,4S)-3-(3-methylbut-2-enoxy)oxan-4-yl]pyrimidine-4-carboxamide (PubChem CID 164630030) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-amino-6-methyl-N-[(3R,4S)-3-(3-methylbut-2-enoxy)oxan-4-yl]pyrimidine-4-carboxamide.
| Compound Name | 2-amino-6-methyl-N-[(3R,4S)-3-(3-methylbut-2-enoxy)oxan-4-yl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 164630030 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 2-amino-6-methyl-N-[(3R,4S)-3-(3-methylbut-2-enoxy)oxan-4-yl]pyrimidine-4-carboxamide |
| SMILES | CC(C)=CCO[C@H]1COCC[C@@H]1NC(=O)c1cc(C)nc(N)n1 |
| InChI | InChI=1S/C16H24N4O3/c1-10(2)4-7-23-14-9-22-6-5-12(14)19-15(21)13-8-11(3)18-16(17)20-13/h4,8,12,14H,5-7,9H2,1-3H3,(H,19,21)(H2,17,18,20)/t12-,14-/m0/s1 |
| InChIKey | KVOWIENTKYVPTD-JSGCOSHPSA-N |
| XLogP | 1.24 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|