C14H20N2O3S — CID 91774050
N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-1,3-thiazole-4-carboxamide (PubChem CID 91774050) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 91774050 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CC(C)=CCO[C@H]1CCOC[C@H]1NC(=O)c1cscn1 |
| InChI | InChI=1S/C14H20N2O3S/c1-10(2)3-6-19-13-4-5-18-7-11(13)16-14(17)12-8-20-9-15-12/h3,8-9,11,13H,4-7H2,1-2H3,(H,16,17)/t11-,13+/m1/s1 |
| InChIKey | KXPXCXMPRXYXRQ-YPMHNXCESA-N |
| XLogP | 2.01 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|