C16H16N2O5S — CID 91783137
4-[(3R,4R)-3-(1,3-thiazole-4-carbonylamino)oxan-4-yl]oxybenzoic acid (PubChem CID 91783137) has the molecular formula C16H16N2O5S and a molecular weight of 348.38 g/mol. Its IUPAC name is 4-[(3R,4R)-3-(1,3-thiazole-4-carbonylamino)oxan-4-yl]oxybenzoic acid.
| Compound Name | 4-[(3R,4R)-3-(1,3-thiazole-4-carbonylamino)oxan-4-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 91783137 |
| Molecular Formula | C16H16N2O5S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 4-[(3R,4R)-3-(1,3-thiazole-4-carbonylamino)oxan-4-yl]oxybenzoic acid |
| SMILES | O=C(O)c1ccc(O[C@@H]2CCOC[C@H]2NC(=O)c2cscn2)cc1 |
| InChI | InChI=1S/C16H16N2O5S/c19-15(13-8-24-9-17-13)18-12-7-22-6-5-14(12)23-11-3-1-10(2-4-11)16(20)21/h1-4,8-9,12,14H,5-7H2,(H,18,19)(H,20,21)/t12-,14-/m1/s1 |
| InChIKey | ZKNWIKGOBIXWDB-TZMCWYRMSA-N |
| XLogP | 1.81 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |