C20H17N3O3 — CID 91768615
3-cyano-N-[(3R,4R)-4-(4-cyanophenoxy)oxan-3-yl]benzamide (PubChem CID 91768615) has the molecular formula C20H17N3O3 and a molecular weight of 347.37 g/mol. Its IUPAC name is 3-cyano-N-[(3R,4R)-4-(4-cyanophenoxy)oxan-3-yl]benzamide.
| Compound Name | 3-cyano-N-[(3R,4R)-4-(4-cyanophenoxy)oxan-3-yl]benzamide |
|---|---|
| PubChem CID | 91768615 |
| Molecular Formula | C20H17N3O3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 3-cyano-N-[(3R,4R)-4-(4-cyanophenoxy)oxan-3-yl]benzamide |
| SMILES | N#Cc1ccc(O[C@@H]2CCOC[C@H]2NC(=O)c2cccc(C#N)c2)cc1 |
| InChI | InChI=1S/C20H17N3O3/c21-11-14-4-6-17(7-5-14)26-19-8-9-25-13-18(19)23-20(24)16-3-1-2-15(10-16)12-22/h1-7,10,18-19H,8-9,13H2,(H,23,24)/t18-,19-/m1/s1 |
| InChIKey | DIOHVAYNRPVLPG-RTBURBONSA-N |
| XLogP | 2.40 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |