C17H17N3O3S — CID 91798129
3-amino-N-[(3S,4R)-3-(4-cyanophenoxy)oxan-4-yl]thiophene-2-carboxamide (PubChem CID 91798129) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is 3-amino-N-[(3S,4R)-3-(4-cyanophenoxy)oxan-4-yl]thiophene-2-carboxamide.
| Compound Name | 3-amino-N-[(3S,4R)-3-(4-cyanophenoxy)oxan-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 91798129 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 3-amino-N-[(3S,4R)-3-(4-cyanophenoxy)oxan-4-yl]thiophene-2-carboxamide |
| SMILES | N#Cc1ccc(O[C@@H]2COCC[C@H]2NC(=O)c2sccc2N)cc1 |
| InChI | InChI=1S/C17H17N3O3S/c18-9-11-1-3-12(4-2-11)23-15-10-22-7-5-14(15)20-17(21)16-13(19)6-8-24-16/h1-4,6,8,14-15H,5,7,10,19H2,(H,20,21)/t14-,15-/m1/s1 |
| InChIKey | IBKUJWXPSQRPJS-HUUCEWRRSA-N |
| XLogP | 2.17 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |